C18H20ClN3O3S — CID 9237180
2-(benzenesulfonamido)-N-[(Z)-1-(4-chlorophenyl)butylideneamino]acetamide (PubChem CID 9237180) has the molecular formula C18H20ClN3O3S and a molecular weight of 393.90 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-N-[(Z)-1-(4-chlorophenyl)butylideneamino]acetamide.
| Compound Name | 2-(benzenesulfonamido)-N-[(Z)-1-(4-chlorophenyl)butylideneamino]acetamide |
|---|---|
| PubChem CID | 9237180 |
| Molecular Formula | C18H20ClN3O3S |
| Molecular Weight | 393.90 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-(benzenesulfonamido)-N-[(Z)-1-(4-chlorophenyl)butylideneamino]acetamide |
| SMILES | CCC/C(=N/NC(=O)CNS(=O)(=O)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H20ClN3O3S/c1-2-6-17(14-9-11-15(19)12-10-14)21-22-18(23)13-20-26(24,25)16-7-4-3-5-8-16/h3-5,7-12,20H,2,6,13H2,1H3,(H,22,23)/b21-17- |
| InChIKey | ZUNQEDSRYCCFJC-FXBPSFAMSA-N |
| XLogP | 2.94 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.90 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|