C10H14F2N2O3 — CID 154807639
5-[3-(difluoromethoxy)azetidine-1-carbonyl]-1-methylpyrrolidin-2-one (PubChem CID 154807639) has the molecular formula C10H14F2N2O3 and a molecular weight of 248.23 g/mol. Its IUPAC name is 5-[3-(difluoromethoxy)azetidine-1-carbonyl]-1-methylpyrrolidin-2-one.
| Compound Name | 5-[3-(difluoromethoxy)azetidine-1-carbonyl]-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 154807639 |
| Molecular Formula | C10H14F2N2O3 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 5-[3-(difluoromethoxy)azetidine-1-carbonyl]-1-methylpyrrolidin-2-one |
| SMILES | CN1C(=O)CCC1C(=O)N1CC(OC(F)F)C1 |
| InChI | InChI=1S/C10H14F2N2O3/c1-13-7(2-3-8(13)15)9(16)14-4-6(5-14)17-10(11)12/h6-7,10H,2-5H2,1H3 |
| InChIKey | WVOHCKYGBMFULN-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |