About 5-[3-(4-fluorophenyl)-2,5-dihydropyrrole-1-carbonyl]-1-methylpyrrolidin-2-one
5-[3-(4-fluorophenyl)-2,5-dihydropyrrole-1-carbonyl]-1-methylpyrrolidin-2-one (PubChem CID 167759569) has the molecular formula C16H17FN2O2
and a molecular weight of 288.32 g/mol. Its IUPAC name is 5-[3-(4-fluorophenyl)-2,5-dihydropyrrole-1-carbonyl]-1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 5-[3-(4-fluorophenyl)-2,5-dihydropyrrole-1-carbonyl]-1-methylpyrrolidin-2-one |
| PubChem CID | 167759569 |
| Molecular Formula | C16H17FN2O2 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 5-[3-(4-fluorophenyl)-2,5-dihydropyrrole-1-carbonyl]-1-methylpyrrolidin-2-one |
| SMILES | CN1C(=O)CCC1C(=O)N1CC=C(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C16H17FN2O2/c1-18-14(6-7-15(18)20)16(21)19-9-8-12(10-19)11-2-4-13(17)5-3-11/h2-5,8,14H,6-7,9-10H2,1H3 |
| InChIKey | PTLGRXKBFWUXIG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[3-(4-fluorophenyl)-2,5-dihydropyrrole-1-carbonyl]-1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3-(4-fluorophenyl)-2,5-dihydropyrrole-1-carbonyl]-1-methylpyrrolidin-2-one?
The IUPAC name of 5-[3-(4-fluorophenyl)-2,5-dihydropyrrole-1-carbonyl]-1-methylpyrrolidin-2-one (CID 167759569) is 5-[3-(4-fluorophenyl)-2,5-dihydropyrrole-1-carbonyl]-1-methylpyrrolidin-2-one.
What is the SMILES notation for 5-[3-(4-fluorophenyl)-2,5-dihydropyrrole-1-carbonyl]-1-methylpyrrolidin-2-one?
The canonical SMILES for 5-[3-(4-fluorophenyl)-2,5-dihydropyrrole-1-carbonyl]-1-methylpyrrolidin-2-one is CN1C(=O)CCC1C(=O)N1CC=C(c2ccc(F)cc2)C1.
What is the InChIKey of 5-[3-(4-fluorophenyl)-2,5-dihydropyrrole-1-carbonyl]-1-methylpyrrolidin-2-one?
The InChIKey is PTLGRXKBFWUXIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FN2O2/c1-18-14(6-7-15(18)20)16(21)19-9-8-12(10-19)11-2-4-13(17)5-3-11/h2-5,8,14H,6-7,9-10H2,1H3.
What are the key properties of 5-[3-(4-fluorophenyl)-2,5-dihydropyrrole-1-carbonyl]-1-methylpyrrolidin-2-one?
5-[3-(4-fluorophenyl)-2,5-dihydropyrrole-1-carbonyl]-1-methylpyrrolidin-2-one has a molecular weight of 288.32 g/mol, XLogP of 1.67, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(4-fluorophenyl)-2,5-dihydropyrrole-1-carbonyl]-1-methylpyrrolidin-2-one is sourced from PubChem (CID 167759569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).