C12H15N3O4 — CID 154807735
(6-methyl-4-oxo-1H-pyridazin-3-yl)methyl (2S)-1-methyl-5-oxopyrrolidine-2-carboxylate (PubChem CID 154807735) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is (6-methyl-4-oxo-1H-pyridazin-3-yl)methyl (2S)-1-methyl-5-oxopyrrolidine-2-carboxylate.
| Compound Name | (6-methyl-4-oxo-1H-pyridazin-3-yl)methyl (2S)-1-methyl-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 154807735 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | (6-methyl-4-oxo-1H-pyridazin-3-yl)methyl (2S)-1-methyl-5-oxopyrrolidine-2-carboxylate |
| SMILES | Cc1cc(=O)c(COC(=O)[C@@H]2CCC(=O)N2C)n[nH]1 |
| InChI | InChI=1S/C12H15N3O4/c1-7-5-10(16)8(14-13-7)6-19-12(18)9-3-4-11(17)15(9)2/h5,9H,3-4,6H2,1-2H3,(H,13,16)/t9-/m0/s1 |
| InChIKey | CIMQRCMHTNIHAA-VIFPVBQESA-N |
| XLogP | -0.26 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |