C15H16ClN3O2 — CID 154807888
(2R,3R)-N-(2-chlorophenyl)-3-(pyrazol-1-ylmethyl)oxolane-2-carboxamide (PubChem CID 154807888) has the molecular formula C15H16ClN3O2 and a molecular weight of 305.76 g/mol. Its IUPAC name is (2R,3R)-N-(2-chlorophenyl)-3-(pyrazol-1-ylmethyl)oxolane-2-carboxamide.
| Compound Name | (2R,3R)-N-(2-chlorophenyl)-3-(pyrazol-1-ylmethyl)oxolane-2-carboxamide |
|---|---|
| PubChem CID | 154807888 |
| Molecular Formula | C15H16ClN3O2 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | (2R,3R)-N-(2-chlorophenyl)-3-(pyrazol-1-ylmethyl)oxolane-2-carboxamide |
| SMILES | O=C(Nc1ccccc1Cl)[C@@H]1OCC[C@@H]1Cn1cccn1 |
| InChI | InChI=1S/C15H16ClN3O2/c16-12-4-1-2-5-13(12)18-15(20)14-11(6-9-21-14)10-19-8-3-7-17-19/h1-5,7-8,11,14H,6,9-10H2,(H,18,20)/t11-,14-/m1/s1 |
| InChIKey | FYYMJFIWJYFVCU-BXUZGUMPSA-N |
| XLogP | 2.58 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |