C25H20ClN3O3S — CID 154808168
2-[(1S,2R,6R,7S,8R,12S)-5-(2-chlorophenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 154808168) has the molecular formula C25H20ClN3O3S and a molecular weight of 477.97 g/mol. Its IUPAC name is 2-[(1S,2R,6R,7S,8R,12S)-5-(2-chlorophenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-[(1S,2R,6R,7S,8R,12S)-5-(2-chlorophenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 154808168 |
| Molecular Formula | C25H20ClN3O3S |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 2-[(1S,2R,6R,7S,8R,12S)-5-(2-chlorophenyl)-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-en-10-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | N#Cc1c(N2C(=O)[C@@H]3[C@H]4C[C@H]([C@H]5ON=C(c6ccccc6Cl)[C@@H]45)[C@@H]3C2=O)sc2c1CCCC2 |
| InChI | InChI=1S/C25H20ClN3O3S/c26-16-7-3-1-6-12(16)21-20-13-9-14(22(20)32-28-21)19-18(13)23(30)29(24(19)31)25-15(10-27)11-5-2-4-8-17(11)33-25/h1,3,6-7,13-14,18-20,22H,2,4-5,8-9H2/t13-,14+,18-,19+,20-,22-/m1/s1 |
| InChIKey | YDZPFKLYFNJRDD-UAMFGBHFSA-N |
| XLogP | 4.33 |
| TPSA | 82.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|