C36H37N3O2 — CID 154808646
(1S,9R)-11-[3-(5,7-dimethyl-2,3-diphenylindol-1-yl)-2-hydroxypropyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 154808646) has the molecular formula C36H37N3O2 and a molecular weight of 543.71 g/mol. Its IUPAC name is (1S,9R)-11-[3-(5,7-dimethyl-2,3-diphenylindol-1-yl)-2-hydroxypropyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1S,9R)-11-[3-(5,7-dimethyl-2,3-diphenylindol-1-yl)-2-hydroxypropyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 154808646 |
| Molecular Formula | C36H37N3O2 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | (1S,9R)-11-[3-(5,7-dimethyl-2,3-diphenylindol-1-yl)-2-hydroxypropyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | Cc1cc(C)c2c(c1)c(-c1ccccc1)c(-c1ccccc1)n2CC(O)CN1C[C@H]2C[C@@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C36H37N3O2/c1-24-16-25(2)35-31(17-24)34(27-10-5-3-6-11-27)36(28-12-7-4-8-13-28)39(35)23-30(40)22-37-19-26-18-29(21-37)32-14-9-15-33(41)38(32)20-26/h3-17,26,29-30,40H,18-23H2,1-2H3/t26-,29+,30?/m1/s1 |
| InChIKey | ZLOHVMWPVZSCIQ-MRYMHDLASA-N |
| XLogP | 6.23 |
| TPSA | 50.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |