C26H31N3O2 — CID 154809087
(1S,9R)-11-[2-hydroxy-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 154809087) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is (1S,9R)-11-[2-hydroxy-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1S,9R)-11-[2-hydroxy-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 154809087 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | (1S,9R)-11-[2-hydroxy-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=c1cccc2n1C[C@@H]1C[C@H]2CN(CC(O)Cn2c3c(c4ccccc42)CCCC3)C1 |
| InChI | InChI=1S/C26H31N3O2/c30-20(17-28-24-8-3-1-6-21(24)22-7-2-4-9-25(22)28)16-27-13-18-12-19(15-27)23-10-5-11-26(31)29(23)14-18/h1,3,5-6,8,10-11,18-20,30H,2,4,7,9,12-17H2/t18-,19+,20?/m1/s1 |
| InChIKey | ROTXKTSJRVHHQL-LFPSWIHMSA-N |
| XLogP | 3.16 |
| TPSA | 50.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|