C22H30N2O2 — CID 167696224
1-[1-[2-hydroxy-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propyl]piperidin-3-yl]ethanone (PubChem CID 167696224) has the molecular formula C22H30N2O2 and a molecular weight of 354.49 g/mol. Its IUPAC name is 1-[1-[2-hydroxy-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propyl]piperidin-3-yl]ethanone.
| Compound Name | 1-[1-[2-hydroxy-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propyl]piperidin-3-yl]ethanone |
|---|---|
| PubChem CID | 167696224 |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.23 |
| IUPAC Name | 1-[1-[2-hydroxy-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propyl]piperidin-3-yl]ethanone |
| SMILES | CC(=O)C1CCCN(CC(O)Cn2c3c(c4ccccc42)CCCC3)C1 |
| InChI | InChI=1S/C22H30N2O2/c1-16(25)17-7-6-12-23(13-17)14-18(26)15-24-21-10-4-2-8-19(21)20-9-3-5-11-22(20)24/h2,4,8,10,17-18,26H,3,5-7,9,11-15H2,1H3 |
| InChIKey | JVYIASKMTBUISE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|