C20H28ClN3O — CID 30726611
(2R)-1-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-3-(4-methylpiperazin-1-yl)propan-2-ol (PubChem CID 30726611) has the molecular formula C20H28ClN3O and a molecular weight of 361.92 g/mol. Its IUPAC name is (2R)-1-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-3-(4-methylpiperazin-1-yl)propan-2-ol.
| Compound Name | (2R)-1-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-3-(4-methylpiperazin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 30726611 |
| Molecular Formula | C20H28ClN3O |
| Molecular Weight | 361.92 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (2R)-1-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-3-(4-methylpiperazin-1-yl)propan-2-ol |
| SMILES | CN1CCN(C[C@@H](O)Cn2c3c(c4cccc(Cl)c42)CCCC3)CC1 |
| InChI | InChI=1S/C20H28ClN3O/c1-22-9-11-23(12-10-22)13-15(25)14-24-19-8-3-2-5-16(19)17-6-4-7-18(21)20(17)24/h4,6-7,15,25H,2-3,5,8-14H2,1H3/t15-/m1/s1 |
| InChIKey | NAUNZADOQZNCQT-OAHLLOKOSA-N |
| XLogP | 2.78 |
| TPSA | 31.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.92 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|