C18H20ClN3O3 — CID 35583922
3-[(2S)-3-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-2-hydroxypropyl]imidazolidine-2,4-dione (PubChem CID 35583922) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is 3-[(2S)-3-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-2-hydroxypropyl]imidazolidine-2,4-dione.
| Compound Name | 3-[(2S)-3-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-2-hydroxypropyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 35583922 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 3-[(2S)-3-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-2-hydroxypropyl]imidazolidine-2,4-dione |
| SMILES | O=C1CNC(=O)N1C[C@@H](O)Cn1c2c(c3cccc(Cl)c31)CCCC2 |
| InChI | InChI=1S/C18H20ClN3O3/c19-14-6-3-5-13-12-4-1-2-7-15(12)21(17(13)14)9-11(23)10-22-16(24)8-20-18(22)25/h3,5-6,11,23H,1-2,4,7-10H2,(H,20,25)/t11-/m0/s1 |
| InChIKey | UASASOHSIIUGJY-NSHDSACASA-N |
| XLogP | 2.09 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|