C24H27ClN2O5 — CID 163330966
1-(benzylamino)-3-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol;oxalic acid (PubChem CID 163330966) has the molecular formula C24H27ClN2O5 and a molecular weight of 458.94 g/mol. Its IUPAC name is 1-(benzylamino)-3-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol;oxalic acid.
| Compound Name | 1-(benzylamino)-3-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 163330966 |
| Molecular Formula | C24H27ClN2O5 |
| Molecular Weight | 458.94 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 1-(benzylamino)-3-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol;oxalic acid |
| SMILES | O=C(O)C(=O)O.OC(CNCc1ccccc1)Cn1c2c(c3cccc(Cl)c31)CCCC2 |
| InChI | InChI=1S/C22H25ClN2O.C2H2O4/c23-20-11-6-10-19-18-9-4-5-12-21(18)25(22(19)20)15-17(26)14-24-13-16-7-2-1-3-8-16;3-1(4)2(5)6/h1-3,6-8,10-11,17,24,26H,4-5,9,12-15H2;(H,3,4)(H,5,6) |
| InChIKey | VZFPIDIEUXZHRS-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.94 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|