C23H28N2O6 — CID 2952509
1-(furan-2-ylmethylamino)-3-(6-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol;oxalic acid (PubChem CID 2952509) has the molecular formula C23H28N2O6 and a molecular weight of 428.49 g/mol. Its IUPAC name is 1-(furan-2-ylmethylamino)-3-(6-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol;oxalic acid.
| Compound Name | 1-(furan-2-ylmethylamino)-3-(6-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 2952509 |
| Molecular Formula | C23H28N2O6 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 1-(furan-2-ylmethylamino)-3-(6-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol;oxalic acid |
| SMILES | Cc1ccc2c(c1)c1c(n2CC(O)CNCc2ccco2)CCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H26N2O2.C2H2O4/c1-15-8-9-21-19(11-15)18-6-2-3-7-20(18)23(21)14-16(24)12-22-13-17-5-4-10-25-17;3-1(4)2(5)6/h4-5,8-11,16,22,24H,2-3,6-7,12-14H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | RCADFIKPEGQTAT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|