C32H28N2O2 — CID 1036576
(2R)-1-(2,3-diphenylbenzo[g]indol-1-yl)-3-(furan-2-ylmethylamino)propan-2-ol (PubChem CID 1036576) has the molecular formula C32H28N2O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is (2R)-1-(2,3-diphenylbenzo[g]indol-1-yl)-3-(furan-2-ylmethylamino)propan-2-ol.
| Compound Name | (2R)-1-(2,3-diphenylbenzo[g]indol-1-yl)-3-(furan-2-ylmethylamino)propan-2-ol |
|---|---|
| PubChem CID | 1036576 |
| Molecular Formula | C32H28N2O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | (2R)-1-(2,3-diphenylbenzo[g]indol-1-yl)-3-(furan-2-ylmethylamino)propan-2-ol |
| SMILES | O[C@H](CNCc1ccco1)Cn1c(-c2ccccc2)c(-c2ccccc2)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C32H28N2O2/c35-26(20-33-21-27-15-9-19-36-27)22-34-31(25-13-5-2-6-14-25)30(24-11-3-1-4-12-24)29-18-17-23-10-7-8-16-28(23)32(29)34/h1-19,26,33,35H,20-22H2/t26-/m1/s1 |
| InChIKey | RYVUHZJKNGXKGM-AREMUKBSSA-N |
| XLogP | 6.87 |
| TPSA | 50.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |