C37H36N2O3 — CID 98183195
(2R)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(2,3-diphenylbenzo[g]indol-1-yl)propan-2-ol (PubChem CID 98183195) has the molecular formula C37H36N2O3 and a molecular weight of 556.71 g/mol. Its IUPAC name is (2R)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(2,3-diphenylbenzo[g]indol-1-yl)propan-2-ol.
| Compound Name | (2R)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(2,3-diphenylbenzo[g]indol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 98183195 |
| Molecular Formula | C37H36N2O3 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | (2R)-1-[2-(3,4-dimethoxyphenyl)ethylamino]-3-(2,3-diphenylbenzo[g]indol-1-yl)propan-2-ol |
| SMILES | COc1ccc(CCNC[C@@H](O)Cn2c(-c3ccccc3)c(-c3ccccc3)c3ccc4ccccc4c32)cc1OC |
| InChI | InChI=1S/C37H36N2O3/c1-41-33-20-17-26(23-34(33)42-2)21-22-38-24-30(40)25-39-36(29-14-7-4-8-15-29)35(28-12-5-3-6-13-28)32-19-18-27-11-9-10-16-31(27)37(32)39/h3-20,23,30,38,40H,21-22,24-25H2,1-2H3/t30-/m1/s1 |
| InChIKey | GXFMIAMBUSYTMO-SSEXGKCCSA-N |
| XLogP | 7.34 |
| TPSA | 55.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|