C29H30ClN3O4 — CID 57312967
1-(5-chloro-2,6-diphenylpyrimidin-4-yl)oxy-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-2-ol (PubChem CID 57312967) has the molecular formula C29H30ClN3O4 and a molecular weight of 520.03 g/mol. Its IUPAC name is 1-(5-chloro-2,6-diphenylpyrimidin-4-yl)oxy-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-2-ol.
| Compound Name | 1-(5-chloro-2,6-diphenylpyrimidin-4-yl)oxy-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 57312967 |
| Molecular Formula | C29H30ClN3O4 |
| Molecular Weight | 520.03 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 1-(5-chloro-2,6-diphenylpyrimidin-4-yl)oxy-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-2-ol |
| SMILES | COc1ccc(CCNCC(O)COc2nc(-c3ccccc3)nc(-c3ccccc3)c2Cl)cc1OC |
| InChI | InChI=1S/C29H30ClN3O4/c1-35-24-14-13-20(17-25(24)36-2)15-16-31-18-23(34)19-37-29-26(30)27(21-9-5-3-6-10-21)32-28(33-29)22-11-7-4-8-12-22/h3-14,17,23,31,34H,15-16,18-19H2,1-2H3 |
| InChIKey | BEBCNKRBQDWJAW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.03 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|