About 1-[[(2R)-oxiran-2-yl]methyl]-2,3-diphenylbenzo[g]indole
1-[[(2R)-oxiran-2-yl]methyl]-2,3-diphenylbenzo[g]indole (PubChem CID 40553294) has the molecular formula C27H21NO
and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-[[(2R)-oxiran-2-yl]methyl]-2,3-diphenylbenzo[g]indole.
Molecular Properties
| Compound Name | 1-[[(2R)-oxiran-2-yl]methyl]-2,3-diphenylbenzo[g]indole |
| PubChem CID | 40553294 |
| Molecular Formula | C27H21NO |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 1-[[(2R)-oxiran-2-yl]methyl]-2,3-diphenylbenzo[g]indole |
| SMILES | c1ccc(-c2c(-c3ccccc3)n(C[C@@H]3CO3)c3c2ccc2ccccc23)cc1 |
| InChI | InChI=1S/C27H21NO/c1-3-10-20(11-4-1)25-24-16-15-19-9-7-8-14-23(19)27(24)28(17-22-18-29-22)26(25)21-12-5-2-6-13-21/h1-16,22H,17-18H2/t22-/m1/s1 |
| InChIKey | QBGSYRNMDJJQCY-JOCHJYFZSA-N |
| XLogP | 6.53 |
| TPSA | 17.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-[[(2R)-oxiran-2-yl]methyl]-2,3-diphenylbenzo[g]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(2R)-oxiran-2-yl]methyl]-2,3-diphenylbenzo[g]indole?
The IUPAC name of 1-[[(2R)-oxiran-2-yl]methyl]-2,3-diphenylbenzo[g]indole (CID 40553294) is 1-[[(2R)-oxiran-2-yl]methyl]-2,3-diphenylbenzo[g]indole.
What is the SMILES notation for 1-[[(2R)-oxiran-2-yl]methyl]-2,3-diphenylbenzo[g]indole?
The canonical SMILES for 1-[[(2R)-oxiran-2-yl]methyl]-2,3-diphenylbenzo[g]indole is c1ccc(-c2c(-c3ccccc3)n(C[C@@H]3CO3)c3c2ccc2ccccc23)cc1.
What is the InChIKey of 1-[[(2R)-oxiran-2-yl]methyl]-2,3-diphenylbenzo[g]indole?
The InChIKey is QBGSYRNMDJJQCY-JOCHJYFZSA-N. The full InChI is InChI=1S/C27H21NO/c1-3-10-20(11-4-1)25-24-16-15-19-9-7-8-14-23(19)27(24)28(17-22-18-29-22)26(25)21-12-5-2-6-13-21/h1-16,22H,17-18H2/t22-/m1/s1.
What are the key properties of 1-[[(2R)-oxiran-2-yl]methyl]-2,3-diphenylbenzo[g]indole?
1-[[(2R)-oxiran-2-yl]methyl]-2,3-diphenylbenzo[g]indole has a molecular weight of 375.47 g/mol, XLogP of 6.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(2R)-oxiran-2-yl]methyl]-2,3-diphenylbenzo[g]indole is sourced from PubChem (CID 40553294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).