C41H46N2O5 — CID 163329973
1-(dicyclohexylamino)-3-(2,3-diphenylbenzo[g]indol-1-yl)propan-2-ol;oxalic acid (PubChem CID 163329973) has the molecular formula C41H46N2O5 and a molecular weight of 646.83 g/mol. Its IUPAC name is 1-(dicyclohexylamino)-3-(2,3-diphenylbenzo[g]indol-1-yl)propan-2-ol;oxalic acid.
| Compound Name | 1-(dicyclohexylamino)-3-(2,3-diphenylbenzo[g]indol-1-yl)propan-2-ol;oxalic acid |
|---|---|
| PubChem CID | 163329973 |
| Molecular Formula | C41H46N2O5 |
| Molecular Weight | 646.83 g/mol |
| Exact Mass | 646.34 |
| IUPAC Name | 1-(dicyclohexylamino)-3-(2,3-diphenylbenzo[g]indol-1-yl)propan-2-ol;oxalic acid |
| SMILES | O=C(O)C(=O)O.OC(CN(C1CCCCC1)C1CCCCC1)Cn1c(-c2ccccc2)c(-c2ccccc2)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C39H44N2O.C2H2O4/c42-34(27-40(32-20-9-3-10-21-32)33-22-11-4-12-23-33)28-41-38(31-18-7-2-8-19-31)37(30-16-5-1-6-17-30)36-26-25-29-15-13-14-24-35(29)39(36)41;3-1(4)2(5)6/h1-2,5-8,13-19,24-26,32-34,42H,3-4,9-12,20-23,27-28H2;(H,3,4)(H,5,6) |
| InChIKey | YOMAHAFKHRTRGW-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.83 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|