C29H33N2O+ — CID 3592921
1-(5-methyl-2,3-diphenylindol-1-yl)-3-piperidin-1-ium-1-ylpropan-2-ol (PubChem CID 3592921) has the molecular formula C29H33N2O+ and a molecular weight of 425.60 g/mol. Its IUPAC name is 1-(5-methyl-2,3-diphenylindol-1-yl)-3-piperidin-1-ium-1-ylpropan-2-ol.
| Compound Name | 1-(5-methyl-2,3-diphenylindol-1-yl)-3-piperidin-1-ium-1-ylpropan-2-ol |
|---|---|
| PubChem CID | 3592921 |
| Molecular Formula | C29H33N2O+ |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | 1-(5-methyl-2,3-diphenylindol-1-yl)-3-piperidin-1-ium-1-ylpropan-2-ol |
| SMILES | Cc1ccc2c(c1)c(-c1ccccc1)c(-c1ccccc1)n2CC(O)C[NH+]1CCCCC1 |
| InChI | InChI=1S/C29H32N2O/c1-22-15-16-27-26(19-22)28(23-11-5-2-6-12-23)29(24-13-7-3-8-14-24)31(27)21-25(32)20-30-17-9-4-10-18-30/h2-3,5-8,11-16,19,25,32H,4,9-10,17-18,20-21H2,1H3/p+1 |
| InChIKey | WZRCQMGHRLAAPM-UHFFFAOYSA-O |
| XLogP | 4.71 |
| TPSA | 29.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |