C24H30N2O — CID 141127629
2-(3-cyclohexyl-2-phenylindol-1-yl)-1-(dimethylamino)ethanol (PubChem CID 141127629) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is 2-(3-cyclohexyl-2-phenylindol-1-yl)-1-(dimethylamino)ethanol.
| Compound Name | 2-(3-cyclohexyl-2-phenylindol-1-yl)-1-(dimethylamino)ethanol |
|---|---|
| PubChem CID | 141127629 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 2-(3-cyclohexyl-2-phenylindol-1-yl)-1-(dimethylamino)ethanol |
| SMILES | CN(C)C(O)Cn1c(-c2ccccc2)c(C2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C24H30N2O/c1-25(2)22(27)17-26-21-16-10-9-15-20(21)23(18-11-5-3-6-12-18)24(26)19-13-7-4-8-14-19/h4,7-10,13-16,18,22,27H,3,5-6,11-12,17H2,1-2H3 |
| InChIKey | PLZCMIKHPZUNDQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|