C26H33N3O — CID 2256274
(2S)-1-(4-benzylpiperazin-1-yl)-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol (PubChem CID 2256274) has the molecular formula C26H33N3O and a molecular weight of 403.57 g/mol. Its IUPAC name is (2S)-1-(4-benzylpiperazin-1-yl)-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol.
| Compound Name | (2S)-1-(4-benzylpiperazin-1-yl)-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol |
|---|---|
| PubChem CID | 2256274 |
| Molecular Formula | C26H33N3O |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.26 |
| IUPAC Name | (2S)-1-(4-benzylpiperazin-1-yl)-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol |
| SMILES | O[C@@H](CN1CCN(Cc2ccccc2)CC1)Cn1c2c(c3ccccc31)CCCC2 |
| InChI | InChI=1S/C26H33N3O/c30-22(19-28-16-14-27(15-17-28)18-21-8-2-1-3-9-21)20-29-25-12-6-4-10-23(25)24-11-5-7-13-26(24)29/h1-4,6,8-10,12,22,30H,5,7,11,13-20H2/t22-/m0/s1 |
| InChIKey | QRHHLEHVTPUDHI-QFIPXVFZSA-N |
| XLogP | 3.70 |
| TPSA | 31.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|