C23H29N2O+ — CID 7000328
[(2S)-2-hydroxy-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propyl]-(2-phenylethyl)azanium (PubChem CID 7000328) has the molecular formula C23H29N2O+ and a molecular weight of 349.50 g/mol. Its IUPAC name is [(2S)-2-hydroxy-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propyl]-(2-phenylethyl)azanium.
| Compound Name | [(2S)-2-hydroxy-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propyl]-(2-phenylethyl)azanium |
|---|---|
| PubChem CID | 7000328 |
| Molecular Formula | C23H29N2O+ |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | [(2S)-2-hydroxy-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propyl]-(2-phenylethyl)azanium |
| SMILES | O[C@@H](C[NH2+]CCc1ccccc1)Cn1c2c(c3ccccc31)CCCC2 |
| InChI | InChI=1S/C23H28N2O/c26-19(16-24-15-14-18-8-2-1-3-9-18)17-25-22-12-6-4-10-20(22)21-11-5-7-13-23(21)25/h1-4,6,8-10,12,19,24,26H,5,7,11,13-17H2/p+1/t19-/m0/s1 |
| InChIKey | AQNRERQKCDUYAR-IBGZPJMESA-O |
| XLogP | 2.69 |
| TPSA | 41.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|