C24H30N2O — CID 56930792
1-(2-phenylpropan-2-ylamino)-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol (PubChem CID 56930792) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is 1-(2-phenylpropan-2-ylamino)-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol.
| Compound Name | 1-(2-phenylpropan-2-ylamino)-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol |
|---|---|
| PubChem CID | 56930792 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 1-(2-phenylpropan-2-ylamino)-3-(1,2,3,4-tetrahydrocarbazol-9-yl)propan-2-ol |
| SMILES | CC(C)(NCC(O)Cn1c2c(c3ccccc31)CCCC2)c1ccccc1 |
| InChI | InChI=1S/C24H30N2O/c1-24(2,18-10-4-3-5-11-18)25-16-19(27)17-26-22-14-8-6-12-20(22)21-13-7-9-15-23(21)26/h3-6,8,10-12,14,19,25,27H,7,9,13,15-17H2,1-2H3 |
| InChIKey | VTJOYWRIYLVMOK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|