C23H27ClN2O — CID 35583542
(2S)-1-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-3-[[(1S)-1-phenylethyl]amino]propan-2-ol (PubChem CID 35583542) has the molecular formula C23H27ClN2O and a molecular weight of 382.94 g/mol. Its IUPAC name is (2S)-1-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-3-[[(1S)-1-phenylethyl]amino]propan-2-ol.
| Compound Name | (2S)-1-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-3-[[(1S)-1-phenylethyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 35583542 |
| Molecular Formula | C23H27ClN2O |
| Molecular Weight | 382.94 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (2S)-1-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-3-[[(1S)-1-phenylethyl]amino]propan-2-ol |
| SMILES | C[C@H](NC[C@H](O)Cn1c2c(c3cccc(Cl)c31)CCCC2)c1ccccc1 |
| InChI | InChI=1S/C23H27ClN2O/c1-16(17-8-3-2-4-9-17)25-14-18(27)15-26-22-13-6-5-10-19(22)20-11-7-12-21(24)23(20)26/h2-4,7-9,11-12,16,18,25,27H,5-6,10,13-15H2,1H3/t16-,18-/m0/s1 |
| InChIKey | GSUDRDNINUXOFS-WMZOPIPTSA-N |
| XLogP | 4.89 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.94 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|