C17H23ClN2O2 — CID 42589661
(2R)-1-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-3-(2-hydroxyethylamino)propan-2-ol (PubChem CID 42589661) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is (2R)-1-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-3-(2-hydroxyethylamino)propan-2-ol.
| Compound Name | (2R)-1-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-3-(2-hydroxyethylamino)propan-2-ol |
|---|---|
| PubChem CID | 42589661 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | (2R)-1-(8-chloro-1,2,3,4-tetrahydrocarbazol-9-yl)-3-(2-hydroxyethylamino)propan-2-ol |
| SMILES | OCCNC[C@@H](O)Cn1c2c(c3cccc(Cl)c31)CCCC2 |
| InChI | InChI=1S/C17H23ClN2O2/c18-15-6-3-5-14-13-4-1-2-7-16(13)20(17(14)15)11-12(22)10-19-8-9-21/h3,5-6,12,19,21-22H,1-2,4,7-11H2/t12-/m1/s1 |
| InChIKey | YQRCRBYMNWFGDC-GFCCVEGCSA-N |
| XLogP | 2.12 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|