C20H27N3O2 — CID 3154656
9-(2-hydroxy-3-piperidin-1-ylpropyl)-2-methyl-3,4-dihydropyrido[3,4-b]indol-1-one (PubChem CID 3154656) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is 9-(2-hydroxy-3-piperidin-1-ylpropyl)-2-methyl-3,4-dihydropyrido[3,4-b]indol-1-one.
| Compound Name | 9-(2-hydroxy-3-piperidin-1-ylpropyl)-2-methyl-3,4-dihydropyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 3154656 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 9-(2-hydroxy-3-piperidin-1-ylpropyl)-2-methyl-3,4-dihydropyrido[3,4-b]indol-1-one |
| SMILES | CN1CCc2c(n(CC(O)CN3CCCCC3)c3ccccc23)C1=O |
| InChI | InChI=1S/C20H27N3O2/c1-21-12-9-17-16-7-3-4-8-18(16)23(19(17)20(21)25)14-15(24)13-22-10-5-2-6-11-22/h3-4,7-8,15,24H,2,5-6,9-14H2,1H3 |
| InChIKey | VSYADFFFVQHHES-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|