C20H28N3O2+ — CID 7069542
cyclopentyl-[(2S)-2-hydroxy-3-(2-methyl-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl)propyl]azanium (PubChem CID 7069542) has the molecular formula C20H28N3O2+ and a molecular weight of 342.46 g/mol. Its IUPAC name is cyclopentyl-[(2S)-2-hydroxy-3-(2-methyl-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl)propyl]azanium.
| Compound Name | cyclopentyl-[(2S)-2-hydroxy-3-(2-methyl-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl)propyl]azanium |
|---|---|
| PubChem CID | 7069542 |
| Molecular Formula | C20H28N3O2+ |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | cyclopentyl-[(2S)-2-hydroxy-3-(2-methyl-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl)propyl]azanium |
| SMILES | CN1CCc2c(n(C[C@@H](O)C[NH2+]C3CCCC3)c3ccccc23)C1=O |
| InChI | InChI=1S/C20H27N3O2/c1-22-11-10-17-16-8-4-5-9-18(16)23(19(17)20(22)25)13-15(24)12-21-14-6-2-3-7-14/h4-5,8-9,14-15,21,24H,2-3,6-7,10-13H2,1H3/p+1/t15-/m0/s1 |
| InChIKey | UCPUYOMUIKVFJV-HNNXBMFYSA-O |
| XLogP | 1.14 |
| TPSA | 62.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|