C20H27N3O3 — CID 1085881
9-[(2S)-2-hydroxy-3-[[(2R)-oxolan-2-yl]methylamino]propyl]-2-methyl-3,4-dihydropyrido[3,4-b]indol-1-one (PubChem CID 1085881) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is 9-[(2S)-2-hydroxy-3-[[(2R)-oxolan-2-yl]methylamino]propyl]-2-methyl-3,4-dihydropyrido[3,4-b]indol-1-one.
| Compound Name | 9-[(2S)-2-hydroxy-3-[[(2R)-oxolan-2-yl]methylamino]propyl]-2-methyl-3,4-dihydropyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 1085881 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 9-[(2S)-2-hydroxy-3-[[(2R)-oxolan-2-yl]methylamino]propyl]-2-methyl-3,4-dihydropyrido[3,4-b]indol-1-one |
| SMILES | CN1CCc2c(n(C[C@@H](O)CNC[C@H]3CCCO3)c3ccccc23)C1=O |
| InChI | InChI=1S/C20H27N3O3/c1-22-9-8-17-16-6-2-3-7-18(16)23(19(17)20(22)25)13-14(24)11-21-12-15-5-4-10-26-15/h2-3,6-7,14-15,21,24H,4-5,8-13H2,1H3/t14-,15+/m0/s1 |
| InChIKey | QFXPZVNWRKDXDF-LSDHHAIUSA-N |
| XLogP | 1.40 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|