C30H28N4O2 — CID 40927037
9-[(2R)-3-(4,5-diphenylimidazol-1-yl)-2-hydroxypropyl]-2-methyl-3,4-dihydropyrido[3,4-b]indol-1-one (PubChem CID 40927037) has the molecular formula C30H28N4O2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 9-[(2R)-3-(4,5-diphenylimidazol-1-yl)-2-hydroxypropyl]-2-methyl-3,4-dihydropyrido[3,4-b]indol-1-one.
| Compound Name | 9-[(2R)-3-(4,5-diphenylimidazol-1-yl)-2-hydroxypropyl]-2-methyl-3,4-dihydropyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 40927037 |
| Molecular Formula | C30H28N4O2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.22 |
| IUPAC Name | 9-[(2R)-3-(4,5-diphenylimidazol-1-yl)-2-hydroxypropyl]-2-methyl-3,4-dihydropyrido[3,4-b]indol-1-one |
| SMILES | CN1CCc2c(n(C[C@@H](O)Cn3cnc(-c4ccccc4)c3-c3ccccc3)c3ccccc23)C1=O |
| InChI | InChI=1S/C30H28N4O2/c1-32-17-16-25-24-14-8-9-15-26(24)34(29(25)30(32)36)19-23(35)18-33-20-31-27(21-10-4-2-5-11-21)28(33)22-12-6-3-7-13-22/h2-15,20,23,35H,16-19H2,1H3/t23-/m0/s1 |
| InChIKey | GEMYLMLESXPANP-QHCPKHFHSA-N |
| XLogP | 4.86 |
| TPSA | 63.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|