C19H25N3O3 — CID 713053
9-[(2S)-2-hydroxy-3-morpholin-4-ylpropyl]-2-methyl-3,4-dihydropyrido[3,4-b]indol-1-one (PubChem CID 713053) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is 9-[(2S)-2-hydroxy-3-morpholin-4-ylpropyl]-2-methyl-3,4-dihydropyrido[3,4-b]indol-1-one.
| Compound Name | 9-[(2S)-2-hydroxy-3-morpholin-4-ylpropyl]-2-methyl-3,4-dihydropyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 713053 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 9-[(2S)-2-hydroxy-3-morpholin-4-ylpropyl]-2-methyl-3,4-dihydropyrido[3,4-b]indol-1-one |
| SMILES | CN1CCc2c(n(C[C@@H](O)CN3CCOCC3)c3ccccc23)C1=O |
| InChI | InChI=1S/C19H25N3O3/c1-20-7-6-16-15-4-2-3-5-17(15)22(18(16)19(20)24)13-14(23)12-21-8-10-25-11-9-21/h2-5,14,23H,6-13H2,1H3/t14-/m0/s1 |
| InChIKey | VATIEHMBFYAPDR-AWEZNQCLSA-N |
| XLogP | 0.96 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|