C23H24ClN3O6 — CID 44655398
(4-chlorophenyl)-[2-hydroxy-3-(2-methyl-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl)propyl]azanium;2-hydroxy-2-oxoacetate (PubChem CID 44655398) has the molecular formula C23H24ClN3O6 and a molecular weight of 473.91 g/mol. Its IUPAC name is (4-chlorophenyl)-[2-hydroxy-3-(2-methyl-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl)propyl]azanium;2-hydroxy-2-oxoacetate.
| Compound Name | (4-chlorophenyl)-[2-hydroxy-3-(2-methyl-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl)propyl]azanium;2-hydroxy-2-oxoacetate |
|---|---|
| PubChem CID | 44655398 |
| Molecular Formula | C23H24ClN3O6 |
| Molecular Weight | 473.91 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | (4-chlorophenyl)-[2-hydroxy-3-(2-methyl-1-oxo-3,4-dihydropyrido[3,4-b]indol-9-yl)propyl]azanium;2-hydroxy-2-oxoacetate |
| SMILES | CN1CCc2c(n(CC(O)C[NH2+]c3ccc(Cl)cc3)c3ccccc23)C1=O.O=C([O-])C(=O)O |
| InChI | InChI=1S/C21H22ClN3O2.C2H2O4/c1-24-11-10-18-17-4-2-3-5-19(17)25(20(18)21(24)27)13-16(26)12-23-15-8-6-14(22)7-9-15;3-1(4)2(5)6/h2-9,16,23,26H,10-13H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | JPNUFYUVMAKYCY-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 139.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.91 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|