C23H20N2O — CID 11850984
(1S)-2-(4,5-diphenylimidazol-1-yl)-1-phenylethanol (PubChem CID 11850984) has the molecular formula C23H20N2O and a molecular weight of 340.43 g/mol. Its IUPAC name is (1S)-2-(4,5-diphenylimidazol-1-yl)-1-phenylethanol.
| Compound Name | (1S)-2-(4,5-diphenylimidazol-1-yl)-1-phenylethanol |
|---|---|
| PubChem CID | 11850984 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (1S)-2-(4,5-diphenylimidazol-1-yl)-1-phenylethanol |
| SMILES | O[C@H](Cn1cnc(-c2ccccc2)c1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H20N2O/c26-21(18-10-4-1-5-11-18)16-25-17-24-22(19-12-6-2-7-13-19)23(25)20-14-8-3-9-15-20/h1-15,17,21,26H,16H2/t21-/m1/s1 |
| InChIKey | UPSPTFNCCBUEKY-OAQYLSRUSA-N |
| XLogP | 4.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |