C21H19N3OS — CID 50967271
2-[5-(3-methylthiophen-2-yl)-4-phenylimidazol-1-yl]-1-pyridin-3-ylethanol (PubChem CID 50967271) has the molecular formula C21H19N3OS and a molecular weight of 361.47 g/mol. Its IUPAC name is 2-[5-(3-methylthiophen-2-yl)-4-phenylimidazol-1-yl]-1-pyridin-3-ylethanol.
| Compound Name | 2-[5-(3-methylthiophen-2-yl)-4-phenylimidazol-1-yl]-1-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 50967271 |
| Molecular Formula | C21H19N3OS |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-[5-(3-methylthiophen-2-yl)-4-phenylimidazol-1-yl]-1-pyridin-3-ylethanol |
| SMILES | Cc1ccsc1-c1c(-c2ccccc2)ncn1CC(O)c1cccnc1 |
| InChI | InChI=1S/C21H19N3OS/c1-15-9-11-26-21(15)20-19(16-6-3-2-4-7-16)23-14-24(20)13-18(25)17-8-5-10-22-12-17/h2-12,14,18,25H,13H2,1H3 |
| InChIKey | FDCOBARPGLSKPI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |