C24H23N3O2 — CID 95127760
(1R)-2-[5-(2-ethoxyphenyl)-4-phenylimidazol-1-yl]-1-pyridin-3-ylethanol (PubChem CID 95127760) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is (1R)-2-[5-(2-ethoxyphenyl)-4-phenylimidazol-1-yl]-1-pyridin-3-ylethanol.
| Compound Name | (1R)-2-[5-(2-ethoxyphenyl)-4-phenylimidazol-1-yl]-1-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 95127760 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (1R)-2-[5-(2-ethoxyphenyl)-4-phenylimidazol-1-yl]-1-pyridin-3-ylethanol |
| SMILES | CCOc1ccccc1-c1c(-c2ccccc2)ncn1C[C@H](O)c1cccnc1 |
| InChI | InChI=1S/C24H23N3O2/c1-2-29-22-13-7-6-12-20(22)24-23(18-9-4-3-5-10-18)26-17-27(24)16-21(28)19-11-8-14-25-15-19/h3-15,17,21,28H,2,16H2,1H3/t21-/m0/s1 |
| InChIKey | TZCOPXGHHLWQSQ-NRFANRHFSA-N |
| XLogP | 4.74 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |