C20H22Br2N2O2 — CID 991224
(2S)-1-(3,6-dibromocarbazol-9-yl)-3-[[(2S)-oxolan-2-yl]methylamino]propan-2-ol (PubChem CID 991224) has the molecular formula C20H22Br2N2O2 and a molecular weight of 482.22 g/mol. Its IUPAC name is (2S)-1-(3,6-dibromocarbazol-9-yl)-3-[[(2S)-oxolan-2-yl]methylamino]propan-2-ol.
| Compound Name | (2S)-1-(3,6-dibromocarbazol-9-yl)-3-[[(2S)-oxolan-2-yl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 991224 |
| Molecular Formula | C20H22Br2N2O2 |
| Molecular Weight | 482.22 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | (2S)-1-(3,6-dibromocarbazol-9-yl)-3-[[(2S)-oxolan-2-yl]methylamino]propan-2-ol |
| SMILES | O[C@@H](CNC[C@@H]1CCCO1)Cn1c2ccc(Br)cc2c2cc(Br)ccc21 |
| InChI | InChI=1S/C20H22Br2N2O2/c21-13-3-5-19-17(8-13)18-9-14(22)4-6-20(18)24(19)12-15(25)10-23-11-16-2-1-7-26-16/h3-6,8-9,15-16,23,25H,1-2,7,10-12H2/t15-,16-/m0/s1 |
| InChIKey | LAQAENADPYABIU-HOTGVXAUSA-N |
| XLogP | 4.45 |
| TPSA | 46.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.22 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |