C11H10N2O3S2 — CID 154810387
N-methylsulfonyl-3-(1,3-thiazol-4-yl)benzamide (PubChem CID 154810387) has the molecular formula C11H10N2O3S2 and a molecular weight of 282.35 g/mol. Its IUPAC name is N-methylsulfonyl-3-(1,3-thiazol-4-yl)benzamide.
| Compound Name | N-methylsulfonyl-3-(1,3-thiazol-4-yl)benzamide |
|---|---|
| PubChem CID | 154810387 |
| Molecular Formula | C11H10N2O3S2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | N-methylsulfonyl-3-(1,3-thiazol-4-yl)benzamide |
| SMILES | CS(=O)(=O)NC(=O)c1cccc(-c2cscn2)c1 |
| InChI | InChI=1S/C11H10N2O3S2/c1-18(15,16)13-11(14)9-4-2-3-8(5-9)10-6-17-7-12-10/h2-7H,1H3,(H,13,14) |
| InChIKey | HHOQNXJXAPKQFL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |