C15H22N4O3 — CID 154811393
(3aR,7aR)-2-[4-(dimethylamino)-5-methylpyrimidin-2-yl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid (PubChem CID 154811393) has the molecular formula C15H22N4O3 and a molecular weight of 306.37 g/mol. Its IUPAC name is (3aR,7aR)-2-[4-(dimethylamino)-5-methylpyrimidin-2-yl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aR,7aR)-2-[4-(dimethylamino)-5-methylpyrimidin-2-yl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 154811393 |
| Molecular Formula | C15H22N4O3 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (3aR,7aR)-2-[4-(dimethylamino)-5-methylpyrimidin-2-yl]-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrole-3a-carboxylic acid |
| SMILES | Cc1cnc(N2C[C@@H]3CCOC[C@]3(C(=O)O)C2)nc1N(C)C |
| InChI | InChI=1S/C15H22N4O3/c1-10-6-16-14(17-12(10)18(2)3)19-7-11-4-5-22-9-15(11,8-19)13(20)21/h6,11H,4-5,7-9H2,1-3H3,(H,20,21)/t11-,15+/m0/s1 |
| InChIKey | QYPXAXMZOJHVNM-XHDPSFHLSA-N |
| XLogP | 0.78 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |