C22H28N2O4 — CID 154811502
1-[1-[2-[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-oxoethyl]indol-3-yl]butan-1-one (PubChem CID 154811502) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 1-[1-[2-[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-oxoethyl]indol-3-yl]butan-1-one.
| Compound Name | 1-[1-[2-[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-oxoethyl]indol-3-yl]butan-1-one |
|---|---|
| PubChem CID | 154811502 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 1-[1-[2-[(3aS,7aR)-3a-(hydroxymethyl)-1,3,4,6,7,7a-hexahydropyrano[3,4-c]pyrrol-2-yl]-2-oxoethyl]indol-3-yl]butan-1-one |
| SMILES | CCCC(=O)c1cn(CC(=O)N2C[C@@H]3CCOC[C@]3(CO)C2)c2ccccc12 |
| InChI | InChI=1S/C22H28N2O4/c1-2-5-20(26)18-11-23(19-7-4-3-6-17(18)19)12-21(27)24-10-16-8-9-28-15-22(16,13-24)14-25/h3-4,6-7,11,16,25H,2,5,8-10,12-15H2,1H3/t16-,22+/m0/s1 |
| InChIKey | MKGPFOKAOHAXQQ-KSFYIVLOSA-N |
| XLogP | 2.48 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |