C19H31N3O — CID 154812962
(3aS,5S,6S,7aR)-2-(cyclopentylmethyl)-5-methoxy-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 154812962) has the molecular formula C19H31N3O and a molecular weight of 317.48 g/mol. Its IUPAC name is (3aS,5S,6S,7aR)-2-(cyclopentylmethyl)-5-methoxy-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aS,5S,6S,7aR)-2-(cyclopentylmethyl)-5-methoxy-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 154812962 |
| Molecular Formula | C19H31N3O |
| Molecular Weight | 317.48 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | (3aS,5S,6S,7aR)-2-(cyclopentylmethyl)-5-methoxy-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | CO[C@H]1C[C@@H]2CN(CC3CCCC3)C[C@@H]2C[C@@H]1n1cc(C)cn1 |
| InChI | InChI=1S/C19H31N3O/c1-14-9-20-22(10-14)18-7-16-12-21(11-15-5-3-4-6-15)13-17(16)8-19(18)23-2/h9-10,15-19H,3-8,11-13H2,1-2H3/t16-,17+,18-,19-/m0/s1 |
| InChIKey | MXIFPPSTIJEIGJ-RDGPPVDQSA-N |
| XLogP | 3.28 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |