C23H30FN3O — CID 154812935
(3aS,5S,6S,7aR)-5-(cyclopropylmethoxy)-2-[(3-fluorophenyl)methyl]-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 154812935) has the molecular formula C23H30FN3O and a molecular weight of 383.51 g/mol. Its IUPAC name is (3aS,5S,6S,7aR)-5-(cyclopropylmethoxy)-2-[(3-fluorophenyl)methyl]-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aS,5S,6S,7aR)-5-(cyclopropylmethoxy)-2-[(3-fluorophenyl)methyl]-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 154812935 |
| Molecular Formula | C23H30FN3O |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.24 |
| IUPAC Name | (3aS,5S,6S,7aR)-5-(cyclopropylmethoxy)-2-[(3-fluorophenyl)methyl]-6-(4-methylpyrazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | Cc1cnn([C@H]2C[C@H]3CN(Cc4cccc(F)c4)C[C@H]3C[C@@H]2OCC2CC2)c1 |
| InChI | InChI=1S/C23H30FN3O/c1-16-10-25-27(11-16)22-8-19-13-26(12-18-3-2-4-21(24)7-18)14-20(19)9-23(22)28-15-17-5-6-17/h2-4,7,10-11,17,19-20,22-23H,5-6,8-9,12-15H2,1H3/t19-,20+,22-,23-/m0/s1 |
| InChIKey | BGLDKQYGOJFAMI-MQFRRQCYSA-N |
| XLogP | 4.21 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |