C26H32N6O — CID 176503600
(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-[4-(4-methylphenyl)triazol-1-yl]-2-(pyrazin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole (PubChem CID 176503600) has the molecular formula C26H32N6O and a molecular weight of 444.58 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-[4-(4-methylphenyl)triazol-1-yl]-2-(pyrazin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole.
| Compound Name | (3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-[4-(4-methylphenyl)triazol-1-yl]-2-(pyrazin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
|---|---|
| PubChem CID | 176503600 |
| Molecular Formula | C26H32N6O |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | (3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-[4-(4-methylphenyl)triazol-1-yl]-2-(pyrazin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindole |
| SMILES | Cc1ccc(-c2cn([C@@H]3C[C@@H]4CN(Cc5cnccn5)C[C@@H]4C[C@H]3OCC3CC3)nn2)cc1 |
| InChI | InChI=1S/C26H32N6O/c1-18-2-6-20(7-3-18)24-16-32(30-29-24)25-10-21-13-31(15-23-12-27-8-9-28-23)14-22(21)11-26(25)33-17-19-4-5-19/h2-3,6-9,12,16,19,21-22,25-26H,4-5,10-11,13-15,17H2,1H3/t21-,22+,25-,26-/m1/s1 |
| InChIKey | YPZHLGCYAYKMDY-USXZWKKNSA-N |
| XLogP | 3.92 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |