C22H30ClN5O2 — CID 176501593
2-[1-[(3aS,5R,6R,7aR)-2-(5-chloro-2-pyridinyl)-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]triazol-4-yl]propan-2-ol (PubChem CID 176501593) has the molecular formula C22H30ClN5O2 and a molecular weight of 431.97 g/mol. Its IUPAC name is 2-[1-[(3aS,5R,6R,7aR)-2-(5-chloro-2-pyridinyl)-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]triazol-4-yl]propan-2-ol.
| Compound Name | 2-[1-[(3aS,5R,6R,7aR)-2-(5-chloro-2-pyridinyl)-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]triazol-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 176501593 |
| Molecular Formula | C22H30ClN5O2 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 2-[1-[(3aS,5R,6R,7aR)-2-(5-chloro-2-pyridinyl)-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]triazol-4-yl]propan-2-ol |
| SMILES | CC(C)(O)c1cn([C@@H]2C[C@@H]3CN(c4ccc(Cl)cn4)C[C@@H]3C[C@H]2OCC2CC2)nn1 |
| InChI | InChI=1S/C22H30ClN5O2/c1-22(2,29)20-12-28(26-25-20)18-7-15-10-27(21-6-5-17(23)9-24-21)11-16(15)8-19(18)30-13-14-3-4-14/h5-6,9,12,14-16,18-19,29H,3-4,7-8,10-11,13H2,1-2H3/t15-,16+,18-,19-/m1/s1 |
| InChIKey | BCTWFIRZTSYDAF-UKBAYJJMSA-N |
| XLogP | 3.44 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |