C23H33N5O3 — CID 176505206
[(3aS,5R,6R,7aR)-5-(4-tert-butyltriazol-1-yl)-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-methyl-1,3-oxazol-4-yl)methanone (PubChem CID 176505206) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is [(3aS,5R,6R,7aR)-5-(4-tert-butyltriazol-1-yl)-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-methyl-1,3-oxazol-4-yl)methanone.
| Compound Name | [(3aS,5R,6R,7aR)-5-(4-tert-butyltriazol-1-yl)-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-methyl-1,3-oxazol-4-yl)methanone |
|---|---|
| PubChem CID | 176505206 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | [(3aS,5R,6R,7aR)-5-(4-tert-butyltriazol-1-yl)-6-(cyclopropylmethoxy)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(2-methyl-1,3-oxazol-4-yl)methanone |
| SMILES | Cc1nc(C(=O)N2C[C@H]3C[C@@H](n4cc(C(C)(C)C)nn4)[C@H](OCC4CC4)C[C@H]3C2)co1 |
| InChI | InChI=1S/C23H33N5O3/c1-14-24-18(13-30-14)22(29)27-9-16-7-19(28-11-21(25-26-28)23(2,3)4)20(8-17(16)10-27)31-12-15-5-6-15/h11,13,15-17,19-20H,5-10,12H2,1-4H3/t16-,17+,19-,20-/m1/s1 |
| InChIKey | WJCMCCYZQOLIKL-PIKOESSRSA-N |
| XLogP | 3.39 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |