C25H32N4O2 — CID 176505645
[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(4-cyclopropyltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-methylphenyl)methanone (PubChem CID 176505645) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(4-cyclopropyltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-methylphenyl)methanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(4-cyclopropyltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-methylphenyl)methanone |
|---|---|
| PubChem CID | 176505645 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-(4-cyclopropyltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-(3-methylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)N2C[C@H]3C[C@@H](n4cc(C5CC5)nn4)[C@H](OCC4CC4)C[C@H]3C2)c1 |
| InChI | InChI=1S/C25H32N4O2/c1-16-3-2-4-19(9-16)25(30)28-12-20-10-23(29-14-22(26-27-29)18-7-8-18)24(11-21(20)13-28)31-15-17-5-6-17/h2-4,9,14,17-18,20-21,23-24H,5-8,10-13,15H2,1H3/t20-,21+,23-,24-/m1/s1 |
| InChIKey | FIWNPBRUHKGPRD-CBJLPSGESA-N |
| XLogP | 3.98 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |