C21H32N4O3 — CID 175643137
[(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-cyclobutylmethanone (PubChem CID 175643137) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-cyclobutylmethanone.
| Compound Name | [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-cyclobutylmethanone |
|---|---|
| PubChem CID | 175643137 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | [(3aR,5R,6R,7aS)-5-(cyclopropylmethoxy)-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-cyclobutylmethanone |
| SMILES | COCc1cn([C@@H]2C[C@@H]3CN(C(=O)C4CCC4)C[C@@H]3C[C@H]2OCC2CC2)nn1 |
| InChI | InChI=1S/C21H32N4O3/c1-27-13-18-11-25(23-22-18)19-7-16-9-24(21(26)15-3-2-4-15)10-17(16)8-20(19)28-12-14-5-6-14/h11,14-17,19-20H,2-10,12-13H2,1H3/t16-,17+,19-,20-/m1/s1 |
| InChIKey | QWRKSFCVUGWVEL-PIKOESSRSA-N |
| XLogP | 2.43 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |