C18H24N4O3S — CID 175641221
1-[(3aR,5R,6R,7aS)-5-hydroxy-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-thiophen-3-ylethanone (PubChem CID 175641221) has the molecular formula C18H24N4O3S and a molecular weight of 376.48 g/mol. Its IUPAC name is 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 175641221 |
| Molecular Formula | C18H24N4O3S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 1-[(3aR,5R,6R,7aS)-5-hydroxy-6-[4-(methoxymethyl)triazol-1-yl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-2-thiophen-3-ylethanone |
| SMILES | COCc1cn([C@@H]2C[C@@H]3CN(C(=O)Cc4ccsc4)C[C@@H]3C[C@H]2O)nn1 |
| InChI | InChI=1S/C18H24N4O3S/c1-25-10-15-9-22(20-19-15)16-5-13-7-21(8-14(13)6-17(16)23)18(24)4-12-2-3-26-11-12/h2-3,9,11,13-14,16-17,23H,4-8,10H2,1H3/t13-,14+,16-,17-/m1/s1 |
| InChIKey | BJPXWYNGKGAOEP-YALNPMBYSA-N |
| XLogP | 1.50 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |