C21H25N5O2S — CID 176504492
(3aR,5R,6R,7aS)-2-[(6-methoxy-2-pyridinyl)methyl]-6-(4-thiophen-3-yltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 176504492) has the molecular formula C21H25N5O2S and a molecular weight of 411.53 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-2-[(6-methoxy-2-pyridinyl)methyl]-6-(4-thiophen-3-yltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-2-[(6-methoxy-2-pyridinyl)methyl]-6-(4-thiophen-3-yltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 176504492 |
| Molecular Formula | C21H25N5O2S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (3aR,5R,6R,7aS)-2-[(6-methoxy-2-pyridinyl)methyl]-6-(4-thiophen-3-yltriazol-1-yl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | COc1cccc(CN2C[C@H]3C[C@@H](n4cc(-c5ccsc5)nn4)[C@H](O)C[C@H]3C2)n1 |
| InChI | InChI=1S/C21H25N5O2S/c1-28-21-4-2-3-17(22-21)11-25-9-15-7-19(20(27)8-16(15)10-25)26-12-18(23-24-26)14-5-6-29-13-14/h2-6,12-13,15-16,19-20,27H,7-11H2,1H3/t15-,16+,19-,20-/m1/s1 |
| InChIKey | IKZOKAAMWQBSRR-WOUAJJJCSA-N |
| XLogP | 2.85 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |