C19H30N4O — CID 172664274
(3aR,5R,6R,7aS)-6-(4-methylpiperazin-1-yl)-2-(pyridin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172664274) has the molecular formula C19H30N4O and a molecular weight of 330.48 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-6-(4-methylpiperazin-1-yl)-2-(pyridin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-6-(4-methylpiperazin-1-yl)-2-(pyridin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172664274 |
| Molecular Formula | C19H30N4O |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (3aR,5R,6R,7aS)-6-(4-methylpiperazin-1-yl)-2-(pyridin-2-ylmethyl)-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | CN1CCN([C@@H]2C[C@@H]3CN(Cc4ccccn4)C[C@@H]3C[C@H]2O)CC1 |
| InChI | InChI=1S/C19H30N4O/c1-21-6-8-23(9-7-21)18-10-15-12-22(13-16(15)11-19(18)24)14-17-4-2-3-5-20-17/h2-5,15-16,18-19,24H,6-14H2,1H3/t15-,16+,18-,19-/m1/s1 |
| InChIKey | ZVORDUBWQHJALR-UKBAYJJMSA-N |
| XLogP | 0.90 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |