C22H30N4O — CID 172673916
(3aR,5R,6R,7aS)-6-(4-methylpiperazin-1-yl)-2-quinolin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol (PubChem CID 172673916) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is (3aR,5R,6R,7aS)-6-(4-methylpiperazin-1-yl)-2-quinolin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol.
| Compound Name | (3aR,5R,6R,7aS)-6-(4-methylpiperazin-1-yl)-2-quinolin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
|---|---|
| PubChem CID | 172673916 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | (3aR,5R,6R,7aS)-6-(4-methylpiperazin-1-yl)-2-quinolin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-ol |
| SMILES | CN1CCN([C@@H]2C[C@@H]3CN(c4ccnc5ccccc45)C[C@@H]3C[C@H]2O)CC1 |
| InChI | InChI=1S/C22H30N4O/c1-24-8-10-25(11-9-24)21-12-16-14-26(15-17(16)13-22(21)27)20-6-7-23-19-5-3-2-4-18(19)20/h2-7,16-17,21-22,27H,8-15H2,1H3/t16-,17+,21-,22-/m1/s1 |
| InChIKey | GXSDGABXSJZPLG-WOSNLTMFSA-N |
| XLogP | 2.06 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |