C22H24N4O2S — CID 172667143
N-[(3aR,5S,6S,7aS)-6-hydroxy-2-quinolin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 172667143) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is N-[(3aR,5S,6S,7aS)-6-hydroxy-2-quinolin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2-quinolin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 172667143 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[(3aR,5S,6S,7aS)-6-hydroxy-2-quinolin-4-yl-1,3,3a,4,5,6,7,7a-octahydroisoindol-5-yl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ncsc1C(=O)N[C@H]1C[C@H]2CN(c3ccnc4ccccc34)C[C@H]2C[C@@H]1O |
| InChI | InChI=1S/C22H24N4O2S/c1-13-21(29-12-24-13)22(28)25-18-8-14-10-26(11-15(14)9-20(18)27)19-6-7-23-17-5-3-2-4-16(17)19/h2-7,12,14-15,18,20,27H,8-11H2,1H3,(H,25,28)/t14-,15+,18-,20-/m0/s1 |
| InChIKey | NFKORLFGCAKAOL-ZDUSMZPESA-N |
| XLogP | 3.01 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |